C14H19NO5 — CID 152504774
[(3-hydroxyphenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl] acetate (PubChem CID 152504774) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is [(3-hydroxyphenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl] acetate.
| Compound Name | [(3-hydroxyphenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl] acetate |
|---|---|
| PubChem CID | 152504774 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [(3-hydroxyphenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl] acetate |
| SMILES | CC(=O)OC(NC(=O)OC(C)(C)C)c1cccc(O)c1 |
| InChI | InChI=1S/C14H19NO5/c1-9(16)19-12(10-6-5-7-11(17)8-10)15-13(18)20-14(2,3)4/h5-8,12,17H,1-4H3,(H,15,18) |
| InChIKey | YEFJLVKEQFBDRG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|