C18H30OSi — CID 15252454
(2R)-2-[dimethyl(phenyl)silyl]-2-[(1S,2S)-2-pentylcyclopropyl]ethanol (PubChem CID 15252454) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is (2R)-2-[dimethyl(phenyl)silyl]-2-[(1S,2S)-2-pentylcyclopropyl]ethanol.
| Compound Name | (2R)-2-[dimethyl(phenyl)silyl]-2-[(1S,2S)-2-pentylcyclopropyl]ethanol |
|---|---|
| PubChem CID | 15252454 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (2R)-2-[dimethyl(phenyl)silyl]-2-[(1S,2S)-2-pentylcyclopropyl]ethanol |
| SMILES | CCCCC[C@H]1C[C@@H]1[C@H](CO)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H30OSi/c1-4-5-7-10-15-13-17(15)18(14-19)20(2,3)16-11-8-6-9-12-16/h6,8-9,11-12,15,17-19H,4-5,7,10,13-14H2,1-3H3/t15-,17-,18-/m0/s1 |
| InChIKey | UNGVJZQQXFREJC-SZMVWBNQSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|