C11H11F3N2O — CID 152530690
2-(3,4,4-trifluorobut-3-enyl)benzohydrazide (PubChem CID 152530690) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 2-(3,4,4-trifluorobut-3-enyl)benzohydrazide.
| Compound Name | 2-(3,4,4-trifluorobut-3-enyl)benzohydrazide |
|---|---|
| PubChem CID | 152530690 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-(3,4,4-trifluorobut-3-enyl)benzohydrazide |
| SMILES | NNC(=O)c1ccccc1CCC(F)=C(F)F |
| InChI | InChI=1S/C11H11F3N2O/c12-9(10(13)14)6-5-7-3-1-2-4-8(7)11(17)16-15/h1-4H,5-6,15H2,(H,16,17) |
| InChIKey | YJLZJVAGZZJPEP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|