C18H19NO3 — CID 152533167
methyl (2S)-2-amino-3-(1,2-diphenylethyl)oxirane-2-carboxylate (PubChem CID 152533167) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(1,2-diphenylethyl)oxirane-2-carboxylate.
| Compound Name | methyl (2S)-2-amino-3-(1,2-diphenylethyl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 152533167 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | methyl (2S)-2-amino-3-(1,2-diphenylethyl)oxirane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(N)OC1C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-21-17(20)18(19)16(22-18)15(14-10-6-3-7-11-14)12-13-8-4-2-5-9-13/h2-11,15-16H,12,19H2,1H3/t15?,16?,18-/m0/s1 |
| InChIKey | YJYHKLVKQUWKHS-HTWSVDAQSA-N |
| XLogP | 2.24 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|