C13H13F6NO3 — CID 152554906
ethyl N-methoxy-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]carbamate (PubChem CID 152554906) has the molecular formula C13H13F6NO3 and a molecular weight of 345.24 g/mol. Its IUPAC name is ethyl N-methoxy-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]carbamate.
| Compound Name | ethyl N-methoxy-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 152554906 |
| Molecular Formula | C13H13F6NO3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | ethyl N-methoxy-N-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]carbamate |
| SMILES | CCOC(=O)N(OC)C(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C13H13F6NO3/c1-3-23-11(21)20(22-2)10(13(17,18)19)8-5-4-6-9(7-8)12(14,15)16/h4-7,10H,3H2,1-2H3 |
| InChIKey | YOGRCKLCLHRAML-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|