C11H22N4O2 — CID 152564294
2-amino-2-(1-hexyltriazol-4-yl)propane-1,3-diol (PubChem CID 152564294) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-amino-2-(1-hexyltriazol-4-yl)propane-1,3-diol.
| Compound Name | 2-amino-2-(1-hexyltriazol-4-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 152564294 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-amino-2-(1-hexyltriazol-4-yl)propane-1,3-diol |
| SMILES | CCCCCCn1cc(C(N)(CO)CO)nn1 |
| InChI | InChI=1S/C11H22N4O2/c1-2-3-4-5-6-15-7-10(13-14-15)11(12,8-16)9-17/h7,16-17H,2-6,8-9,12H2,1H3 |
| InChIKey | YQDOAOZVXZTIMA-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|