C17H13F3O2S — CID 15258334
methyl (2S)-3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate (PubChem CID 15258334) has the molecular formula C17H13F3O2S and a molecular weight of 338.35 g/mol. Its IUPAC name is methyl (2S)-3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate.
| Compound Name | methyl (2S)-3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate |
|---|---|
| PubChem CID | 15258334 |
| Molecular Formula | C17H13F3O2S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | methyl (2S)-3,3-diphenyl-2-(trifluoromethyl)thiirane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C(F)(F)F)SC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13F3O2S/c1-22-14(21)16(17(18,19)20)15(23-16,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3/t16-/m1/s1 |
| InChIKey | XUJACKCKKGVTMB-MRXNPFEDSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|