C16H27NO3Si — CID 152590073
2-[2-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]pyridine-3-carboxylic acid (PubChem CID 152590073) has the molecular formula C16H27NO3Si and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 152590073 |
| Molecular Formula | C16H27NO3Si |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]pyridine-3-carboxylic acid |
| SMILES | CC(C)(Cc1ncccc1C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H27NO3Si/c1-15(2,3)21(6,7)20-16(4,5)11-13-12(14(18)19)9-8-10-17-13/h8-10H,11H2,1-7H3,(H,18,19) |
| InChIKey | YVHIPOWTPWFGMK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|