C17H23F3S — CID 15259644
[(Z)-5,5,5-trifluoro-4-hexylsulfanylpent-3-enyl]benzene (PubChem CID 15259644) has the molecular formula C17H23F3S and a molecular weight of 316.43 g/mol. Its IUPAC name is [(Z)-5,5,5-trifluoro-4-hexylsulfanylpent-3-enyl]benzene.
| Compound Name | [(Z)-5,5,5-trifluoro-4-hexylsulfanylpent-3-enyl]benzene |
|---|---|
| PubChem CID | 15259644 |
| Molecular Formula | C17H23F3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(Z)-5,5,5-trifluoro-4-hexylsulfanylpent-3-enyl]benzene |
| SMILES | CCCCCCS/C(=C\CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H23F3S/c1-2-3-4-8-14-21-16(17(18,19)20)13-9-12-15-10-6-5-7-11-15/h5-7,10-11,13H,2-4,8-9,12,14H2,1H3/b16-13- |
| InChIKey | IFIVGBWCFKSPSF-SSZFMOIBSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|