C16H17NO — CID 15259766
(NE)-N-(3,3-diphenylbutan-2-ylidene)hydroxylamine (PubChem CID 15259766) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (NE)-N-(3,3-diphenylbutan-2-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(3,3-diphenylbutan-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 15259766 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (NE)-N-(3,3-diphenylbutan-2-ylidene)hydroxylamine |
| SMILES | C/C(=N\O)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-13(17-18)16(2,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,18H,1-2H3/b17-13+ |
| InChIKey | GAQYXTZDNPNJTO-GHRIWEEISA-N |
| XLogP | 3.84 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|