About 2-(2-ethylhexoxy)ethanol
2-(2-ethylhexoxy)ethanol (PubChem CID 15260) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is 2-(2-ethylhexoxy)ethanol.
Molecular Properties
| Compound Name | 2-(2-ethylhexoxy)ethanol |
| PubChem CID | 15260 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | 2-(2-ethylhexoxy)ethanol |
| SMILES | CCCCC(CC)COCCO |
| InChI | InChI=1S/C10H22O2/c1-3-5-6-10(4-2)9-12-8-7-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | OHJYHAOODFPJOD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethylhexoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylhexoxy)ethanol?
The IUPAC name of 2-(2-ethylhexoxy)ethanol (CID 15260) is 2-(2-ethylhexoxy)ethanol.
What is the SMILES notation for 2-(2-ethylhexoxy)ethanol?
The canonical SMILES for 2-(2-ethylhexoxy)ethanol is CCCCC(CC)COCCO.
What is the InChIKey of 2-(2-ethylhexoxy)ethanol?
The InChIKey is OHJYHAOODFPJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2/c1-3-5-6-10(4-2)9-12-8-7-11/h10-11H,3-9H2,1-2H3.
What are the key properties of 2-(2-ethylhexoxy)ethanol?
2-(2-ethylhexoxy)ethanol has a molecular weight of 174.28 g/mol, XLogP of 2.21, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylhexoxy)ethanol is sourced from PubChem (CID 15260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).