C14H30O2 — CID 24982
2-(2,6,8-trimethylnonan-4-yloxy)ethanol (PubChem CID 24982) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is 2-(2,6,8-trimethylnonan-4-yloxy)ethanol.
| Compound Name | 2-(2,6,8-trimethylnonan-4-yloxy)ethanol |
|---|---|
| PubChem CID | 24982 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 2-(2,6,8-trimethylnonan-4-yloxy)ethanol |
| SMILES | CC(C)CC(C)CC(CC(C)C)OCCO |
| InChI | InChI=1S/C14H30O2/c1-11(2)8-13(5)10-14(9-12(3)4)16-7-6-15/h11-15H,6-10H2,1-5H3 |
| InChIKey | VKKFWRYCMZBXIG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |