C17H22Cl2N2OSSi — CID 15260477
2-tert-butyl-4-chloro-5-[[(3-chlorophenyl)-dimethylsilyl]methylsulfanyl]pyridazin-3-one (PubChem CID 15260477) has the molecular formula C17H22Cl2N2OSSi and a molecular weight of 401.44 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[(3-chlorophenyl)-dimethylsilyl]methylsulfanyl]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[(3-chlorophenyl)-dimethylsilyl]methylsulfanyl]pyridazin-3-one |
|---|---|
| PubChem CID | 15260477 |
| Molecular Formula | C17H22Cl2N2OSSi |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[(3-chlorophenyl)-dimethylsilyl]methylsulfanyl]pyridazin-3-one |
| SMILES | CC(C)(C)n1ncc(SC[Si](C)(C)c2cccc(Cl)c2)c(Cl)c1=O |
| InChI | InChI=1S/C17H22Cl2N2OSSi/c1-17(2,3)21-16(22)15(19)14(10-20-21)23-11-24(4,5)13-8-6-7-12(18)9-13/h6-10H,11H2,1-5H3 |
| InChIKey | ZRVAPLHADSSMTO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|