C26H31ClN2O4S2 — CID 140870631
4-[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)sulfanylmethyl]phenyl]butyl phenylmethanesulfonate (PubChem CID 140870631) has the molecular formula C26H31ClN2O4S2 and a molecular weight of 535.13 g/mol. Its IUPAC name is 4-[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)sulfanylmethyl]phenyl]butyl phenylmethanesulfonate.
| Compound Name | 4-[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)sulfanylmethyl]phenyl]butyl phenylmethanesulfonate |
|---|---|
| PubChem CID | 140870631 |
| Molecular Formula | C26H31ClN2O4S2 |
| Molecular Weight | 535.13 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 4-[4-[(1-tert-butyl-5-chloro-6-oxopyridazin-4-yl)sulfanylmethyl]phenyl]butyl phenylmethanesulfonate |
| SMILES | CC(C)(C)n1ncc(SCc2ccc(CCCCOS(=O)(=O)Cc3ccccc3)cc2)c(Cl)c1=O |
| InChI | InChI=1S/C26H31ClN2O4S2/c1-26(2,3)29-25(30)24(27)23(17-28-29)34-18-21-14-12-20(13-15-21)9-7-8-16-33-35(31,32)19-22-10-5-4-6-11-22/h4-6,10-15,17H,7-9,16,18-19H2,1-3H3 |
| InChIKey | VMNRWPJIMBRXKS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.13 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|