C21H21ClN2OS — CID 13469257
2-tert-butyl-4-chloro-5-[(4-phenylphenyl)methylsulfanyl]pyridazin-3-one (PubChem CID 13469257) has the molecular formula C21H21ClN2OS and a molecular weight of 384.93 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[(4-phenylphenyl)methylsulfanyl]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[(4-phenylphenyl)methylsulfanyl]pyridazin-3-one |
|---|---|
| PubChem CID | 13469257 |
| Molecular Formula | C21H21ClN2OS |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[(4-phenylphenyl)methylsulfanyl]pyridazin-3-one |
| SMILES | CC(C)(C)n1ncc(SCc2ccc(-c3ccccc3)cc2)c(Cl)c1=O |
| InChI | InChI=1S/C21H21ClN2OS/c1-21(2,3)24-20(25)19(22)18(13-23-24)26-14-15-9-11-17(12-10-15)16-7-5-4-6-8-16/h4-13H,14H2,1-3H3 |
| InChIKey | ZVERMZXXMMXIDP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |