C19H25FN2OS — CID 22358062
2-tert-butyl-5-[(4-tert-butylphenyl)methylsulfanyl]-4-fluoropyridazin-3-one (PubChem CID 22358062) has the molecular formula C19H25FN2OS and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-tert-butyl-5-[(4-tert-butylphenyl)methylsulfanyl]-4-fluoropyridazin-3-one.
| Compound Name | 2-tert-butyl-5-[(4-tert-butylphenyl)methylsulfanyl]-4-fluoropyridazin-3-one |
|---|---|
| PubChem CID | 22358062 |
| Molecular Formula | C19H25FN2OS |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-tert-butyl-5-[(4-tert-butylphenyl)methylsulfanyl]-4-fluoropyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(CSc2cnn(C(C)(C)C)c(=O)c2F)cc1 |
| InChI | InChI=1S/C19H25FN2OS/c1-18(2,3)14-9-7-13(8-10-14)12-24-15-11-21-22(19(4,5)6)17(23)16(15)20/h7-11H,12H2,1-6H3 |
| InChIKey | UVEQUQCDRQITMM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |