C20H27FN2OS — CID 24864282
2-tert-butyl-5-[(4-tert-butylphenyl)methylsulfanyl]-4-(fluoromethyl)pyridazin-3-one (PubChem CID 24864282) has the molecular formula C20H27FN2OS and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-tert-butyl-5-[(4-tert-butylphenyl)methylsulfanyl]-4-(fluoromethyl)pyridazin-3-one.
| Compound Name | 2-tert-butyl-5-[(4-tert-butylphenyl)methylsulfanyl]-4-(fluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 24864282 |
| Molecular Formula | C20H27FN2OS |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-tert-butyl-5-[(4-tert-butylphenyl)methylsulfanyl]-4-(fluoromethyl)pyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(CSc2cnn(C(C)(C)C)c(=O)c2CF)cc1 |
| InChI | InChI=1S/C20H27FN2OS/c1-19(2,3)15-9-7-14(8-10-15)13-25-17-12-22-23(20(4,5)6)18(24)16(17)11-21/h7-10,12H,11,13H2,1-6H3 |
| InChIKey | RRDUZQOBVHRLIU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |