C19H16NOP — CID 15260741
N-diphenylphosphorylcyclohepta-2,4,6-trien-1-imine (PubChem CID 15260741) has the molecular formula C19H16NOP and a molecular weight of 305.32 g/mol. Its IUPAC name is N-diphenylphosphorylcyclohepta-2,4,6-trien-1-imine.
| Compound Name | N-diphenylphosphorylcyclohepta-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 15260741 |
| Molecular Formula | C19H16NOP |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-diphenylphosphorylcyclohepta-2,4,6-trien-1-imine |
| SMILES | O=P(N=c1cccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16NOP/c21-22(18-13-7-3-8-14-18,19-15-9-4-10-16-19)20-17-11-5-1-2-6-12-17/h1-16H |
| InChIKey | QPAFWEJKXGRXNF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|