C10H13F5O2 — CID 152616165
2-methyl-3-(2-methylprop-1-enoxymethyl)-2-(1,1,2,2,2-pentafluoroethyl)oxirane (PubChem CID 152616165) has the molecular formula C10H13F5O2 and a molecular weight of 260.20 g/mol. Its IUPAC name is 2-methyl-3-(2-methylprop-1-enoxymethyl)-2-(1,1,2,2,2-pentafluoroethyl)oxirane.
| Compound Name | 2-methyl-3-(2-methylprop-1-enoxymethyl)-2-(1,1,2,2,2-pentafluoroethyl)oxirane |
|---|---|
| PubChem CID | 152616165 |
| Molecular Formula | C10H13F5O2 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-methyl-3-(2-methylprop-1-enoxymethyl)-2-(1,1,2,2,2-pentafluoroethyl)oxirane |
| SMILES | CC(C)=COCC1OC1(C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F5O2/c1-6(2)4-16-5-7-8(3,17-7)9(11,12)10(13,14)15/h4,7H,5H2,1-3H3 |
| InChIKey | ZANVVDNGQOJZFH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|