About 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane
2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane (PubChem CID 161410756) has the molecular formula C10H15F3O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane.
Molecular Properties
| Compound Name | 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane |
| PubChem CID | 161410756 |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane |
| SMILES | C=C(C)C.FC(F)(F)C1(C2CO2)CCO1 |
| InChI | InChI=1S/C6H7F3O2.C4H8/c7-6(8,9)5(1-2-11-5)4-3-10-4;1-4(2)3/h4H,1-3H2;1H2,2-3H3 |
| InChIKey | VVKXUWLZFIFNJE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane?
The IUPAC name of 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane (CID 161410756) is 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane.
What is the SMILES notation for 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane?
The canonical SMILES for 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane is C=C(C)C.FC(F)(F)C1(C2CO2)CCO1.
What is the InChIKey of 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane?
The InChIKey is VVKXUWLZFIFNJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3O2.C4H8/c7-6(8,9)5(1-2-11-5)4-3-10-4;1-4(2)3/h4H,1-3H2;1H2,2-3H3.
What are the key properties of 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane?
2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane has a molecular weight of 224.22 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-ene;2-(oxiran-2-yl)-2-(trifluoromethyl)oxetane is sourced from PubChem (CID 161410756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).