About 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane
3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane (PubChem CID 159424119) has the molecular formula C9H14F2O2
and a molecular weight of 192.20 g/mol. Its IUPAC name is 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane.
Molecular Properties
| Compound Name | 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane |
| PubChem CID | 159424119 |
| Molecular Formula | C9H14F2O2 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane |
| SMILES | C1CC(C2CO2)O1.C=C(C)C(F)F |
| InChI | InChI=1S/C5H8O2.C4H6F2/c1-2-6-4(1)5-3-7-5;1-3(2)4(5)6/h4-5H,1-3H2;4H,1H2,2H3 |
| InChIKey | LQDBBBDNBSPDHT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane?
The IUPAC name of 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane (CID 159424119) is 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane.
What is the SMILES notation for 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane?
The canonical SMILES for 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane is C1CC(C2CO2)O1.C=C(C)C(F)F.
What is the InChIKey of 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane?
The InChIKey is LQDBBBDNBSPDHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H6F2/c1-2-6-4(1)5-3-7-5;1-3(2)4(5)6/h4-5H,1-3H2;4H,1H2,2H3.
What are the key properties of 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane?
3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane has a molecular weight of 192.20 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-2-methylprop-1-ene;2-(oxiran-2-yl)oxetane is sourced from PubChem (CID 159424119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).