C9H18N2O — CID 152617052
N',N'-di(propan-2-yl)prop-2-enehydrazide (PubChem CID 152617052) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is N',N'-di(propan-2-yl)prop-2-enehydrazide.
| Compound Name | N',N'-di(propan-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 152617052 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | N',N'-di(propan-2-yl)prop-2-enehydrazide |
| SMILES | C=CC(=O)NN(C(C)C)C(C)C |
| InChI | InChI=1S/C9H18N2O/c1-6-9(12)10-11(7(2)3)8(4)5/h6-8H,1H2,2-5H3,(H,10,12) |
| InChIKey | ZASUHDCBRSPJIA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|