C11H18O3 — CID 15261933
[(3E)-6-methylhepta-3,5-dien-2-yl] 2-methoxyacetate (PubChem CID 15261933) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is [(3E)-6-methylhepta-3,5-dien-2-yl] 2-methoxyacetate.
| Compound Name | [(3E)-6-methylhepta-3,5-dien-2-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 15261933 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | [(3E)-6-methylhepta-3,5-dien-2-yl] 2-methoxyacetate |
| SMILES | COCC(=O)OC(C)/C=C/C=C(C)C |
| InChI | InChI=1S/C11H18O3/c1-9(2)6-5-7-10(3)14-11(12)8-13-4/h5-7,10H,8H2,1-4H3/b7-5+ |
| InChIKey | MWTOIACYSNXEMY-FNORWQNLSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|