C12H18O2 — CID 54275945
2,6-dimethylocta-2,5,7-trienyl acetate (PubChem CID 54275945) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2,6-dimethylocta-2,5,7-trienyl acetate.
| Compound Name | 2,6-dimethylocta-2,5,7-trienyl acetate |
|---|---|
| PubChem CID | 54275945 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2,6-dimethylocta-2,5,7-trienyl acetate |
| SMILES | C=CC(C)=CCC=C(C)COC(C)=O |
| InChI | InChI=1S/C12H18O2/c1-5-10(2)7-6-8-11(3)9-14-12(4)13/h5,7-8H,1,6,9H2,2-4H3 |
| InChIKey | RNKUOBQYBVPNSU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|