C21H26SSi — CID 15262975
dimethyl-(1-phenylbut-3-enyl)-(1-phenylsulfanylcyclopropyl)silane (PubChem CID 15262975) has the molecular formula C21H26SSi and a molecular weight of 338.59 g/mol. Its IUPAC name is dimethyl-(1-phenylbut-3-enyl)-(1-phenylsulfanylcyclopropyl)silane.
| Compound Name | dimethyl-(1-phenylbut-3-enyl)-(1-phenylsulfanylcyclopropyl)silane |
|---|---|
| PubChem CID | 15262975 |
| Molecular Formula | C21H26SSi |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | dimethyl-(1-phenylbut-3-enyl)-(1-phenylsulfanylcyclopropyl)silane |
| SMILES | C=CCC(c1ccccc1)[Si](C)(C)C1(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26SSi/c1-4-11-20(18-12-7-5-8-13-18)23(2,3)21(16-17-21)22-19-14-9-6-10-15-19/h4-10,12-15,20H,1,11,16-17H2,2-3H3 |
| InChIKey | PSCKMWCVKALDKQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|