C18H21F3SSi — CID 162406462
trimethyl-[4-[(1R)-2,2,2-trifluoro-1-(3-methylsulfanylphenyl)ethyl]phenyl]silane (PubChem CID 162406462) has the molecular formula C18H21F3SSi and a molecular weight of 354.51 g/mol. Its IUPAC name is trimethyl-[4-[(1R)-2,2,2-trifluoro-1-(3-methylsulfanylphenyl)ethyl]phenyl]silane.
| Compound Name | trimethyl-[4-[(1R)-2,2,2-trifluoro-1-(3-methylsulfanylphenyl)ethyl]phenyl]silane |
|---|---|
| PubChem CID | 162406462 |
| Molecular Formula | C18H21F3SSi |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | trimethyl-[4-[(1R)-2,2,2-trifluoro-1-(3-methylsulfanylphenyl)ethyl]phenyl]silane |
| SMILES | CSc1cccc([C@@H](c2ccc([Si](C)(C)C)cc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H21F3SSi/c1-22-15-7-5-6-14(12-15)17(18(19,20)21)13-8-10-16(11-9-13)23(2,3)4/h5-12,17H,1-4H3/t17-/m1/s1 |
| InChIKey | OVGJYQMXGPBBKP-QGZVFWFLSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|