C16H13F3S — CID 72792639
1-(1,1-difluoro-1-phenylsulfanylbut-3-en-2-yl)-4-fluorobenzene (PubChem CID 72792639) has the molecular formula C16H13F3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-(1,1-difluoro-1-phenylsulfanylbut-3-en-2-yl)-4-fluorobenzene.
| Compound Name | 1-(1,1-difluoro-1-phenylsulfanylbut-3-en-2-yl)-4-fluorobenzene |
|---|---|
| PubChem CID | 72792639 |
| Molecular Formula | C16H13F3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-(1,1-difluoro-1-phenylsulfanylbut-3-en-2-yl)-4-fluorobenzene |
| SMILES | C=CC(c1ccc(F)cc1)C(F)(F)Sc1ccccc1 |
| InChI | InChI=1S/C16H13F3S/c1-2-15(12-8-10-13(17)11-9-12)16(18,19)20-14-6-4-3-5-7-14/h2-11,15H,1H2 |
| InChIKey | OSXMRCRHUZBTPK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|