About 4-chloro-2-fluoro-3-methylbenzoyl isocyanate
4-chloro-2-fluoro-3-methylbenzoyl isocyanate (PubChem CID 152633841) has the molecular formula C9H5ClFNO2
and a molecular weight of 213.59 g/mol. Its IUPAC name is 4-chloro-2-fluoro-3-methylbenzoyl isocyanate.
Molecular Properties
| Compound Name | 4-chloro-2-fluoro-3-methylbenzoyl isocyanate |
| PubChem CID | 152633841 |
| Molecular Formula | C9H5ClFNO2 |
| Molecular Weight | 213.59 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 4-chloro-2-fluoro-3-methylbenzoyl isocyanate |
| SMILES | Cc1c(Cl)ccc(C(=O)N=C=O)c1F |
| InChI | InChI=1S/C9H5ClFNO2/c1-5-7(10)3-2-6(8(5)11)9(14)12-4-13/h2-3H,1H3 |
| InChIKey | ZECJMFQPTXRQFV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-fluoro-3-methylbenzoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-fluoro-3-methylbenzoyl isocyanate?
The IUPAC name of 4-chloro-2-fluoro-3-methylbenzoyl isocyanate (CID 152633841) is 4-chloro-2-fluoro-3-methylbenzoyl isocyanate.
What is the SMILES notation for 4-chloro-2-fluoro-3-methylbenzoyl isocyanate?
The canonical SMILES for 4-chloro-2-fluoro-3-methylbenzoyl isocyanate is Cc1c(Cl)ccc(C(=O)N=C=O)c1F.
What is the InChIKey of 4-chloro-2-fluoro-3-methylbenzoyl isocyanate?
The InChIKey is ZECJMFQPTXRQFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClFNO2/c1-5-7(10)3-2-6(8(5)11)9(14)12-4-13/h2-3H,1H3.
What are the key properties of 4-chloro-2-fluoro-3-methylbenzoyl isocyanate?
4-chloro-2-fluoro-3-methylbenzoyl isocyanate has a molecular weight of 213.59 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-fluoro-3-methylbenzoyl isocyanate is sourced from PubChem (CID 152633841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).