C24H24O4 — CID 15264110
(2S)-3-methyl-2-[(1R)-2-methyl-1-phenylpropoxy]spiro[2,5-dihydropyran-6,2'-indene]-1',3'-dione (PubChem CID 15264110) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(1R)-2-methyl-1-phenylpropoxy]spiro[2,5-dihydropyran-6,2'-indene]-1',3'-dione.
| Compound Name | (2S)-3-methyl-2-[(1R)-2-methyl-1-phenylpropoxy]spiro[2,5-dihydropyran-6,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 15264110 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (2S)-3-methyl-2-[(1R)-2-methyl-1-phenylpropoxy]spiro[2,5-dihydropyran-6,2'-indene]-1',3'-dione |
| SMILES | CC1=CCC2(O[C@@H]1O[C@@H](c1ccccc1)C(C)C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H24O4/c1-15(2)20(17-9-5-4-6-10-17)27-23-16(3)13-14-24(28-23)21(25)18-11-7-8-12-19(18)22(24)26/h4-13,15,20,23H,14H2,1-3H3/t20-,23+/m1/s1 |
| InChIKey | JFAIPCHPBKIBCD-OFNKIYASSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|