C19H15F4N2O3- — CID 152647226
2-[8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-2-methyl-4H-quinazolin-4-yl]acetate (PubChem CID 152647226) has the molecular formula C19H15F4N2O3- and a molecular weight of 395.33 g/mol. Its IUPAC name is 2-[8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-2-methyl-4H-quinazolin-4-yl]acetate.
| Compound Name | 2-[8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-2-methyl-4H-quinazolin-4-yl]acetate |
|---|---|
| PubChem CID | 152647226 |
| Molecular Formula | C19H15F4N2O3- |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-[8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-2-methyl-4H-quinazolin-4-yl]acetate |
| SMILES | COc1ccc(C(F)(F)F)cc1N1C(C)=Nc2c(F)cccc2C1CC(=O)[O-] |
| InChI | InChI=1S/C19H16F4N2O3/c1-10-24-18-12(4-3-5-13(18)20)14(9-17(26)27)25(10)15-8-11(19(21,22)23)6-7-16(15)28-2/h3-8,14H,9H2,1-2H3,(H,26,27)/p-1 |
| InChIKey | ZGUNTAWSMKISRJ-UHFFFAOYSA-M |
| XLogP | 3.60 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |