C20H17ClF4N2O3 — CID 71251582
2-[2-chloro-5-ethyl-8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-4H-quinazolin-4-yl]acetic acid (PubChem CID 71251582) has the molecular formula C20H17ClF4N2O3 and a molecular weight of 444.81 g/mol. Its IUPAC name is 2-[2-chloro-5-ethyl-8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-4H-quinazolin-4-yl]acetic acid.
| Compound Name | 2-[2-chloro-5-ethyl-8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-4H-quinazolin-4-yl]acetic acid |
|---|---|
| PubChem CID | 71251582 |
| Molecular Formula | C20H17ClF4N2O3 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 2-[2-chloro-5-ethyl-8-fluoro-3-[2-methoxy-5-(trifluoromethyl)phenyl]-4H-quinazolin-4-yl]acetic acid |
| SMILES | CCc1ccc(F)c2c1C(CC(=O)O)N(c1cc(C(F)(F)F)ccc1OC)C(Cl)=N2 |
| InChI | InChI=1S/C20H17ClF4N2O3/c1-3-10-4-6-12(22)18-17(10)14(9-16(28)29)27(19(21)26-18)13-8-11(20(23,24)25)5-7-15(13)30-2/h4-8,14H,3,9H2,1-2H3,(H,28,29) |
| InChIKey | SVAGBSPQLVYKMC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|