C27H53O6PS — CID 152650381
2-(3-decylsulfanyldodecan-2-ylperoxy)-2-phosphoroso-2-propoxyacetic acid (PubChem CID 152650381) has the molecular formula C27H53O6PS and a molecular weight of 536.76 g/mol. Its IUPAC name is 2-(3-decylsulfanyldodecan-2-ylperoxy)-2-phosphoroso-2-propoxyacetic acid.
| Compound Name | 2-(3-decylsulfanyldodecan-2-ylperoxy)-2-phosphoroso-2-propoxyacetic acid |
|---|---|
| PubChem CID | 152650381 |
| Molecular Formula | C27H53O6PS |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 2-(3-decylsulfanyldodecan-2-ylperoxy)-2-phosphoroso-2-propoxyacetic acid |
| SMILES | CCCCCCCCCCSC(CCCCCCCCC)C(C)OOC(OCCC)(P=O)C(=O)O |
| InChI | InChI=1S/C27H53O6PS/c1-5-8-10-12-14-16-18-20-23-35-25(21-19-17-15-13-11-9-6-2)24(4)32-33-27(34-30,26(28)29)31-22-7-3/h24-25H,5-23H2,1-4H3,(H,28,29) |
| InChIKey | ZHKVFXBBRNRDJJ-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|