About sodium 2-methylundecane
sodium 2-methylundecane (PubChem CID 152655175) has the molecular formula C12H25Na
and a molecular weight of 192.32 g/mol. Its IUPAC name is sodium 2-methylundecane.
Molecular Properties
| Compound Name | sodium 2-methylundecane |
| PubChem CID | 152655175 |
| Molecular Formula | C12H25Na |
| Molecular Weight | 192.32 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | sodium 2-methylundecane |
| SMILES | CCCCCCCCC[C-](C)C.[Na+] |
| InChI | InChI=1S/C12H25.Na/c1-4-5-6-7-8-9-10-11-12(2)3;/h4-11H2,1-3H3;/q-1;+1 |
| InChIKey | INNVRKCKKQCCSV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-methylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methylundecane?
The IUPAC name of sodium 2-methylundecane (CID 152655175) is sodium 2-methylundecane.
What is the SMILES notation for sodium 2-methylundecane?
The canonical SMILES for sodium 2-methylundecane is CCCCCCCCC[C-](C)C.[Na+].
What is the InChIKey of sodium 2-methylundecane?
The InChIKey is INNVRKCKKQCCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25.Na/c1-4-5-6-7-8-9-10-11-12(2)3;/h4-11H2,1-3H3;/q-1;+1.
What are the key properties of sodium 2-methylundecane?
sodium 2-methylundecane has a molecular weight of 192.32 g/mol, XLogP of 1.75, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methylundecane is sourced from PubChem (CID 152655175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).