About sodium hexadecane-1,1-diol
sodium hexadecane-1,1-diol (PubChem CID 87492358) has the molecular formula C16H33NaO2
and a molecular weight of 280.43 g/mol. Its IUPAC name is sodium hexadecane-1,1-diol.
Molecular Properties
| Compound Name | sodium hexadecane-1,1-diol |
| PubChem CID | 87492358 |
| Molecular Formula | C16H33NaO2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | sodium hexadecane-1,1-diol |
| SMILES | CCCCCCCCCCCCCCC[C-](O)O.[Na+] |
| InChI | InChI=1S/C16H33O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h17-18H,2-15H2,1H3;/q-1;+1 |
| InChIKey | FYOATUKVZVZXBP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium hexadecane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium hexadecane-1,1-diol?
The IUPAC name of sodium hexadecane-1,1-diol (CID 87492358) is sodium hexadecane-1,1-diol.
What is the SMILES notation for sodium hexadecane-1,1-diol?
The canonical SMILES for sodium hexadecane-1,1-diol is CCCCCCCCCCCCCCC[C-](O)O.[Na+].
What is the InChIKey of sodium hexadecane-1,1-diol?
The InChIKey is FYOATUKVZVZXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h17-18H,2-15H2,1H3;/q-1;+1.
What are the key properties of sodium hexadecane-1,1-diol?
sodium hexadecane-1,1-diol has a molecular weight of 280.43 g/mol, XLogP of 2.71, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium hexadecane-1,1-diol is sourced from PubChem (CID 87492358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).