C42H62O6 — CID 15266031
(1S,3R,10S,12R)-6,7,15,16-tetrahexoxy-19,20-dioxahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-4,6,8,13,15,17-hexaene (PubChem CID 15266031) has the molecular formula C42H62O6 and a molecular weight of 662.95 g/mol. Its IUPAC name is (1S,3R,10S,12R)-6,7,15,16-tetrahexoxy-19,20-dioxahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-4,6,8,13,15,17-hexaene.
| Compound Name | (1S,3R,10S,12R)-6,7,15,16-tetrahexoxy-19,20-dioxahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-4,6,8,13,15,17-hexaene |
|---|---|
| PubChem CID | 15266031 |
| Molecular Formula | C42H62O6 |
| Molecular Weight | 662.95 g/mol |
| Exact Mass | 662.45 |
| IUPAC Name | (1S,3R,10S,12R)-6,7,15,16-tetrahexoxy-19,20-dioxahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-4,6,8,13,15,17-hexaene |
| SMILES | CCCCCCOc1cc2c(cc1OCCCCCC)[C@@H]1O[C@H]2C2C1[C@@H]1O[C@H]2c2cc(OCCCCCC)c(OCCCCCC)cc21 |
| InChI | InChI=1S/C42H62O6/c1-5-9-13-17-21-43-33-25-29-30(26-34(33)44-22-18-14-10-6-2)40-38-37(39(29)47-40)41-31-27-35(45-23-19-15-11-7-3)36(28-32(31)42(38)48-41)46-24-20-16-12-8-4/h25-28,37-42H,5-24H2,1-4H3/t37?,38?,39-,40+,41+,42- |
| InChIKey | LSQFPVWPOXGTOQ-DOOQPAALSA-N |
| XLogP | 11.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.95 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|