C14H21NO2 — CID 15268436
[(1R,4S)-4-[bis(prop-2-enyl)amino]cyclohex-2-en-1-yl] acetate (PubChem CID 15268436) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is [(1R,4S)-4-[bis(prop-2-enyl)amino]cyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,4S)-4-[bis(prop-2-enyl)amino]cyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 15268436 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | [(1R,4S)-4-[bis(prop-2-enyl)amino]cyclohex-2-en-1-yl] acetate |
| SMILES | C=CCN(CC=C)[C@@H]1C=C[C@H](OC(C)=O)CC1 |
| InChI | InChI=1S/C14H21NO2/c1-4-10-15(11-5-2)13-6-8-14(9-7-13)17-12(3)16/h4-6,8,13-14H,1-2,7,9-11H2,3H3/t13-,14+/m1/s1 |
| InChIKey | PPZISBBSEQRSGL-KGLIPLIRSA-N |
| XLogP | 2.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|