C11H15F2NO4 — CID 152690947
2-(3-ethoxy-3-oxoprop-1-enyl)-5,5-difluoropiperidine-1-carboxylic acid (PubChem CID 152690947) has the molecular formula C11H15F2NO4 and a molecular weight of 263.24 g/mol. Its IUPAC name is 2-(3-ethoxy-3-oxoprop-1-enyl)-5,5-difluoropiperidine-1-carboxylic acid.
| Compound Name | 2-(3-ethoxy-3-oxoprop-1-enyl)-5,5-difluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 152690947 |
| Molecular Formula | C11H15F2NO4 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-(3-ethoxy-3-oxoprop-1-enyl)-5,5-difluoropiperidine-1-carboxylic acid |
| SMILES | CCOC(=O)C=CC1CCC(F)(F)CN1C(=O)O |
| InChI | InChI=1S/C11H15F2NO4/c1-2-18-9(15)4-3-8-5-6-11(12,13)7-14(8)10(16)17/h3-4,8H,2,5-7H2,1H3,(H,16,17) |
| InChIKey | ZPNWKRUNUOUGIY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|