About 5-Methylhexane-1,2-diol
5-Methylhexane-1,2-diol (PubChem CID 15270165) has the molecular formula C7H16O2
and a molecular weight of 132.20 g/mol. Its IUPAC name is 5-methylhexane-1,2-diol.
Molecular Properties
| Compound Name | 5-Methylhexane-1,2-diol |
| PubChem CID | 15270165 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | 5-methylhexane-1,2-diol |
| SMILES | CC(C)CCC(CO)O |
| InChI | InChI=1S/C7H16O2/c1-6(2)3-4-7(9)5-8/h6-9H,3-5H2,1-2H3 |
| InChIKey | PTXXRZSKRORMHV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | 61 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-Methylhexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-Methylhexane-1,2-diol?
The IUPAC name of 5-Methylhexane-1,2-diol (CID 15270165) is 5-methylhexane-1,2-diol.
What is the SMILES notation for 5-Methylhexane-1,2-diol?
The canonical SMILES for 5-Methylhexane-1,2-diol is CC(C)CCC(CO)O.
What is the InChIKey of 5-Methylhexane-1,2-diol?
The InChIKey is PTXXRZSKRORMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2/c1-6(2)3-4-7(9)5-8/h6-9H,3-5H2,1-2H3.
What are the key properties of 5-Methylhexane-1,2-diol?
5-Methylhexane-1,2-diol has a molecular weight of 132.20 g/mol, XLogP of 1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-Methylhexane-1,2-diol is sourced from PubChem (CID 15270165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).