C9H20O3 — CID 10487509
(2S,3R,5S,6R)-3,5-dimethylheptane-1,2,6-triol (PubChem CID 10487509) has the molecular formula C9H20O3 and a molecular weight of 176.26 g/mol. Its IUPAC name is (2S,3R,5S,6R)-3,5-dimethylheptane-1,2,6-triol.
| Compound Name | (2S,3R,5S,6R)-3,5-dimethylheptane-1,2,6-triol |
|---|---|
| PubChem CID | 10487509 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | (2S,3R,5S,6R)-3,5-dimethylheptane-1,2,6-triol |
| SMILES | C[C@H](C[C@H](C)[C@@H](C)O)[C@H](O)CO |
| InChI | InChI=1S/C9H20O3/c1-6(8(3)11)4-7(2)9(12)5-10/h6-12H,4-5H2,1-3H3/t6-,7+,8+,9+/m0/s1 |
| InChIKey | PEWTULXJQDARSA-JQCXWYLXSA-N |
| XLogP | 0.38 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |