C27H35F3N2O5S — CID 152724181
5-(cyclopropylmethoxy)-6-[4-(decylsulfonylamino)phenyl]-3-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 152724181) has the molecular formula C27H35F3N2O5S and a molecular weight of 556.65 g/mol. Its IUPAC name is 5-(cyclopropylmethoxy)-6-[4-(decylsulfonylamino)phenyl]-3-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 5-(cyclopropylmethoxy)-6-[4-(decylsulfonylamino)phenyl]-3-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 152724181 |
| Molecular Formula | C27H35F3N2O5S |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 5-(cyclopropylmethoxy)-6-[4-(decylsulfonylamino)phenyl]-3-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | CCCCCCCCCCS(=O)(=O)Nc1ccc(-c2nc(C(=O)O)c(C(F)(F)F)cc2OCC2CC2)cc1 |
| InChI | InChI=1S/C27H35F3N2O5S/c1-2-3-4-5-6-7-8-9-16-38(35,36)32-21-14-12-20(13-15-21)24-23(37-18-19-10-11-19)17-22(27(28,29)30)25(31-24)26(33)34/h12-15,17,19,32H,2-11,16,18H2,1H3,(H,33,34) |
| InChIKey | ZWGGFHLEZSHHPJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|