C25H30F6N2O5S — CID 152720835
6-[4-(decylsulfonylamino)phenyl]-5-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 152720835) has the molecular formula C25H30F6N2O5S and a molecular weight of 584.58 g/mol. Its IUPAC name is 6-[4-(decylsulfonylamino)phenyl]-5-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 6-[4-(decylsulfonylamino)phenyl]-5-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 152720835 |
| Molecular Formula | C25H30F6N2O5S |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 6-[4-(decylsulfonylamino)phenyl]-5-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | CCCCCCCCCCS(=O)(=O)Nc1ccc(-c2nc(C(=O)O)c(C(F)(F)F)cc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H30F6N2O5S/c1-2-3-4-5-6-7-8-9-14-39(36,37)33-18-12-10-17(11-13-18)21-20(38-16-24(26,27)28)15-19(25(29,30)31)22(32-21)23(34)35/h10-13,15,33H,2-9,14,16H2,1H3,(H,34,35) |
| InChIKey | ZVOXHJJBUZNLGC-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|