C30H29F3N2O6S — CID 54214654
3-[3-[6-(4-methoxyphenyl)hex-5-enoxy]-6-[2-[3-(trifluoromethylsulfonylamino)phenyl]ethynyl]-2-pyridinyl]propanoic acid (PubChem CID 54214654) has the molecular formula C30H29F3N2O6S and a molecular weight of 602.63 g/mol. Its IUPAC name is 3-[3-[6-(4-methoxyphenyl)hex-5-enoxy]-6-[2-[3-(trifluoromethylsulfonylamino)phenyl]ethynyl]-2-pyridinyl]propanoic acid.
| Compound Name | 3-[3-[6-(4-methoxyphenyl)hex-5-enoxy]-6-[2-[3-(trifluoromethylsulfonylamino)phenyl]ethynyl]-2-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 54214654 |
| Molecular Formula | C30H29F3N2O6S |
| Molecular Weight | 602.63 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | 3-[3-[6-(4-methoxyphenyl)hex-5-enoxy]-6-[2-[3-(trifluoromethylsulfonylamino)phenyl]ethynyl]-2-pyridinyl]propanoic acid |
| SMILES | COc1ccc(C=CCCCCOc2ccc(C#Cc3cccc(NS(=O)(=O)C(F)(F)F)c3)nc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C30H29F3N2O6S/c1-40-26-15-11-22(12-16-26)7-4-2-3-5-20-41-28-18-14-24(34-27(28)17-19-29(36)37)13-10-23-8-6-9-25(21-23)35-42(38,39)30(31,32)33/h4,6-9,11-12,14-16,18,21,35H,2-3,5,17,19-20H2,1H3,(H,36,37) |
| InChIKey | PYHTXEVCFFVIDL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|