C12H20BrNO3 — CID 152726112
5-bromo-2-tert-butyl-3,3-dimethyl-4-oxopiperidine-1-carboxylic acid (PubChem CID 152726112) has the molecular formula C12H20BrNO3 and a molecular weight of 306.20 g/mol. Its IUPAC name is 5-bromo-2-tert-butyl-3,3-dimethyl-4-oxopiperidine-1-carboxylic acid.
| Compound Name | 5-bromo-2-tert-butyl-3,3-dimethyl-4-oxopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 152726112 |
| Molecular Formula | C12H20BrNO3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 5-bromo-2-tert-butyl-3,3-dimethyl-4-oxopiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1N(C(=O)O)CC(Br)C(=O)C1(C)C |
| InChI | InChI=1S/C12H20BrNO3/c1-11(2,3)9-12(4,5)8(15)7(13)6-14(9)10(16)17/h7,9H,6H2,1-5H3,(H,16,17) |
| InChIKey | ZWQCFQDNJVTPNB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|