C20H30N2O2 — CID 68926998
8-benzyl-1-tert-butyl-2,8-diazaspiro[4.5]decane-2-carboxylic acid (PubChem CID 68926998) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 8-benzyl-1-tert-butyl-2,8-diazaspiro[4.5]decane-2-carboxylic acid.
| Compound Name | 8-benzyl-1-tert-butyl-2,8-diazaspiro[4.5]decane-2-carboxylic acid |
|---|---|
| PubChem CID | 68926998 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 8-benzyl-1-tert-butyl-2,8-diazaspiro[4.5]decane-2-carboxylic acid |
| SMILES | CC(C)(C)C1N(C(=O)O)CCC12CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C20H30N2O2/c1-19(2,3)17-20(11-14-22(17)18(23)24)9-12-21(13-10-20)15-16-7-5-4-6-8-16/h4-8,17H,9-15H2,1-3H3,(H,23,24) |
| InChIKey | WJDQMXJXLABCET-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |