C22H16ClF4N2O4- — CID 152732856
8-[chloro(difluoro)methoxy]-6,7-difluoro-4-oxo-1-[4-(pyrrolidin-1-ylmethyl)phenyl]quinoline-3-carboxylate (PubChem CID 152732856) has the molecular formula C22H16ClF4N2O4- and a molecular weight of 483.83 g/mol. Its IUPAC name is 8-[chloro(difluoro)methoxy]-6,7-difluoro-4-oxo-1-[4-(pyrrolidin-1-ylmethyl)phenyl]quinoline-3-carboxylate.
| Compound Name | 8-[chloro(difluoro)methoxy]-6,7-difluoro-4-oxo-1-[4-(pyrrolidin-1-ylmethyl)phenyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 152732856 |
| Molecular Formula | C22H16ClF4N2O4- |
| Molecular Weight | 483.83 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 8-[chloro(difluoro)methoxy]-6,7-difluoro-4-oxo-1-[4-(pyrrolidin-1-ylmethyl)phenyl]quinoline-3-carboxylate |
| SMILES | O=C([O-])c1cn(-c2ccc(CN3CCCC3)cc2)c2c(OC(F)(F)Cl)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C22H17ClF4N2O4/c23-22(26,27)33-20-17(25)16(24)9-14-18(20)29(11-15(19(14)30)21(31)32)13-5-3-12(4-6-13)10-28-7-1-2-8-28/h3-6,9,11H,1-2,7-8,10H2,(H,31,32)/p-1 |
| InChIKey | ZXZILEZAEIUYDG-UHFFFAOYSA-M |
| XLogP | 3.40 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|