C23H28N4O3 — CID 152737640
2,4-dimethyl-1-[2-(4-methylpiperazin-1-yl)ethyl]-5-[(2-oxo-1H-indol-3-ylidene)methyl]pyrrole-3-carboxylic acid (PubChem CID 152737640) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2,4-dimethyl-1-[2-(4-methylpiperazin-1-yl)ethyl]-5-[(2-oxo-1H-indol-3-ylidene)methyl]pyrrole-3-carboxylic acid.
| Compound Name | 2,4-dimethyl-1-[2-(4-methylpiperazin-1-yl)ethyl]-5-[(2-oxo-1H-indol-3-ylidene)methyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 152737640 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2,4-dimethyl-1-[2-(4-methylpiperazin-1-yl)ethyl]-5-[(2-oxo-1H-indol-3-ylidene)methyl]pyrrole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(C)n(CCN2CCN(C)CC2)c1C=C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C23H28N4O3/c1-15-20(14-18-17-6-4-5-7-19(17)24-22(18)28)27(16(2)21(15)23(29)30)13-12-26-10-8-25(3)9-11-26/h4-7,14H,8-13H2,1-3H3,(H,24,28)(H,29,30) |
| InChIKey | ZYXZOVFAYMZXFF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|