C17H11F6NO4 — CID 152740612
methyl 2-[3,5-bis(trifluoromethyl)phenyl]-3-carbamoyl-4-hydroxybenzoate (PubChem CID 152740612) has the molecular formula C17H11F6NO4 and a molecular weight of 407.27 g/mol. Its IUPAC name is methyl 2-[3,5-bis(trifluoromethyl)phenyl]-3-carbamoyl-4-hydroxybenzoate.
| Compound Name | methyl 2-[3,5-bis(trifluoromethyl)phenyl]-3-carbamoyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 152740612 |
| Molecular Formula | C17H11F6NO4 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | methyl 2-[3,5-bis(trifluoromethyl)phenyl]-3-carbamoyl-4-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(O)c(C(N)=O)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11F6NO4/c1-28-15(27)10-2-3-11(25)13(14(24)26)12(10)7-4-8(16(18,19)20)6-9(5-7)17(21,22)23/h2-6,25H,1H3,(H2,24,26) |
| InChIKey | ZZNOCWCKZDKRPU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |