C25H39NO3 — CID 152744425
[5-(hydroxymethyl)-5-[[8-(2-phenylethoxy)octan-3-ylamino]methyl]cyclohexa-1,3-dien-1-yl]methanol (PubChem CID 152744425) has the molecular formula C25H39NO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is [5-(hydroxymethyl)-5-[[8-(2-phenylethoxy)octan-3-ylamino]methyl]cyclohexa-1,3-dien-1-yl]methanol.
| Compound Name | [5-(hydroxymethyl)-5-[[8-(2-phenylethoxy)octan-3-ylamino]methyl]cyclohexa-1,3-dien-1-yl]methanol |
|---|---|
| PubChem CID | 152744425 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | [5-(hydroxymethyl)-5-[[8-(2-phenylethoxy)octan-3-ylamino]methyl]cyclohexa-1,3-dien-1-yl]methanol |
| SMILES | CCC(CCCCCOCCc1ccccc1)NCC1(CO)C=CC=C(CO)C1 |
| InChI | InChI=1S/C25H39NO3/c1-2-24(26-20-25(21-28)15-9-12-23(18-25)19-27)13-7-4-8-16-29-17-14-22-10-5-3-6-11-22/h3,5-6,9-12,15,24,26-28H,2,4,7-8,13-14,16-21H2,1H3 |
| InChIKey | MJZWGZBRPIJMGC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|