C24H37NO3S — CID 152747422
[5-(hydroxymethyl)-5-[[6-(3-phenylsulfanylpropoxy)hexylamino]methyl]cyclohexa-1,3-dien-1-yl]methanol (PubChem CID 152747422) has the molecular formula C24H37NO3S and a molecular weight of 419.63 g/mol. Its IUPAC name is [5-(hydroxymethyl)-5-[[6-(3-phenylsulfanylpropoxy)hexylamino]methyl]cyclohexa-1,3-dien-1-yl]methanol.
| Compound Name | [5-(hydroxymethyl)-5-[[6-(3-phenylsulfanylpropoxy)hexylamino]methyl]cyclohexa-1,3-dien-1-yl]methanol |
|---|---|
| PubChem CID | 152747422 |
| Molecular Formula | C24H37NO3S |
| Molecular Weight | 419.63 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | [5-(hydroxymethyl)-5-[[6-(3-phenylsulfanylpropoxy)hexylamino]methyl]cyclohexa-1,3-dien-1-yl]methanol |
| SMILES | OCC1=CC=CC(CO)(CNCCCCCCOCCCSc2ccccc2)C1 |
| InChI | InChI=1S/C24H37NO3S/c26-19-22-10-8-13-24(18-22,21-27)20-25-14-6-1-2-7-15-28-16-9-17-29-23-11-4-3-5-12-23/h3-5,8,10-13,25-27H,1-2,6-7,9,14-21H2 |
| InChIKey | SNFKLWKQVWZDDE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|