About 3aH-pyrazolo[3,4-b]pyridine
3aH-pyrazolo[3,4-b]pyridine (PubChem CID 152744460) has the molecular formula C6H5N3
and a molecular weight of 119.13 g/mol. Its IUPAC name is 3aH-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 3aH-pyrazolo[3,4-b]pyridine |
| PubChem CID | 152744460 |
| Molecular Formula | C6H5N3 |
| Molecular Weight | 119.13 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | 3aH-pyrazolo[3,4-b]pyridine |
| SMILES | C1=CC2C=NN=C2N=C1 |
| InChI | InChI=1S/C6H5N3/c1-2-5-4-8-9-6(5)7-3-1/h1-5H |
| InChIKey | XCQNNQVNGVVIIE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.13 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3aH-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3aH-pyrazolo[3,4-b]pyridine?
The IUPAC name of 3aH-pyrazolo[3,4-b]pyridine (CID 152744460) is 3aH-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 3aH-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 3aH-pyrazolo[3,4-b]pyridine is C1=CC2C=NN=C2N=C1.
What is the InChIKey of 3aH-pyrazolo[3,4-b]pyridine?
The InChIKey is XCQNNQVNGVVIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3/c1-2-5-4-8-9-6(5)7-3-1/h1-5H.
What are the key properties of 3aH-pyrazolo[3,4-b]pyridine?
3aH-pyrazolo[3,4-b]pyridine has a molecular weight of 119.13 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3aH-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 152744460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).